Compound Q&A

How is 3-Bromo-5-chlorobenzoic acid (CAS: 42860-02-6) typically synthesized?

Answer

3-Bromo-5-chlorobenzoic acid
3-Bromo-5-chlorobenzoic acid can be synthesized via the bromination of 5-chlorobenzoic acid followed by purification. Commonly, this involves bromination using bromine in the presence of a base such as sodium hydroxide. The yield and selectivity can be improved using appropriate catalysts and conditions.

About

CAS No 42860-02-6
English Name 3-Bromo-5-chlorobenzoic acid
Molecular Formula C7H4BrClO2
Molecular Weight 235.46 g/mol
SMILES C1=C(C=C(C=C1Cl)Br)C(=O)O
InChIKey PBRRUJWXRUGGAW-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-5-chlorobenzoic acid (CAS: 42860-02-6)?

3-Bromo-5-chlorobenzoic acid is a white to off-white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 3-Bromo-5-chlorobenzoic acid (CAS: 42860-02-6)?

3-Bromo-5-chlorobenzoic acid is used in the pharmaceutical industry for the synthesis of certain dru...

Compound Q&A

What precautions should be taken when handling 3-Bromo-5-chlorobenzoic acid (CAS: 42860-02-6)?

When handling 3-Bromo-5-chlorobenzoic acid, it is important to use personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...