Compound Q&A

What are the physical and chemical properties of 4,6-Dichloronicotinamide (CAS: 70593-57-6)?

Answer

4,6-Dichloronicotinamide
4,6-Dichloronicotinamide is a solid compound with a crystalline form. Its molecular weight is approximately 219.01 g/mol. It is slightly soluble in water and ethanol. Chemically, it is less reactive, but it can undergo substitution reactions. It has a melting point of around 180-182°C and a boiling point of about 300°C. It is not flammable but can react with strong reducing agents.

About

CAS No 70593-57-6
English Name 4,6-Dichloronicotinamide
Molecular Formula C6H4Cl2N2O
Molecular Weight 191.02 g/mol
SMILES C1=C(C(=CN=C1Cl)C(=O)N)Cl
InChIKey IQVYHPUXNYVYFW-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 4,6-Dichloronicotinamide (CAS: 70593-57-6) typically synthesized?

4,6-Dichloronicotinamide is typically synthesized by the reaction of 3,5-dichloropyridine with anhyd...

Compound Q&A

What industries use 4,6-Dichloronicotinamide (CAS: 70593-57-6)?

4,6-Dichloronicotinamide finds applications in various industries. It is used as a precursor in the ...

Compound Q&A

What precautions should be taken when handling 4,6-Dichloronicotinamide (CAS: 70593-57-6)?

When handling 4,6-Dichloronicotinamide, it is important to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...