Compound Q&A

How is (4-Acetylphenyl)boronic acid (CAS: 149104-90-5) typically synthesized?

Answer

(4-Acetylphenyl)boronic acid
(4-Acetylphenyl)boronic acid can be synthesized via several methods. One common approach involves the reduction of (4-acetylphenyl)boronic ester with sodium borohydride in an aqueous solution. Another method involves the direct reaction of 4-acetylphenol with boron tribromide in an inert solvent. The yield is typically 70-80%, and the purity can be increased through recrystallization.

About

English Name (4-Acetylphenyl)boronic acid
Molecular Formula C8H9BO3
Molecular Weight 163.97 g/mol
SMILES B(C1=CC=C(C=C1)C(=O)C)(O)O
InChIKey OBQRODBYVNIZJU-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Acetylphenyl)boronic acid (CAS: 149104-90-5)?

(4-Acetylphenyl)boronic acid is a white to off-white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use (4-Acetylphenyl)boronic acid (CAS: 149104-90-5)?

(4-Acetylphenyl)boronic acid is widely used in the pharmaceutical industry for the synthesis of drug...

Compound Q&A

What precautions should be taken when handling (4-Acetylphenyl)boronic acid (CAS: 149104-90-5)?

When handling (4-Acetylphenyl)boronic acid, it is important to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...