Compound Q&A

How is 4-nitropyridin-1-ium-1-olate (CAS: 1124-33-0) typically synthesized?

Answer

4-nitropyridin-1-ium-1-olate
4-nitropyridin-1-ium-1-olate is typically synthesized by the nitration of pyridin-1-ium-1-olate. This process involves the reaction of pyridin-1-ium-1-olate with nitric acid in the presence of a suitable catalyst such as concentrated sulfuric acid. The yield is generally high, and the reaction is selective towards the nitration product.

About

CAS No 1124-33-0
English Name 4-nitropyridin-1-ium-1-olate
Molecular Formula C5H4N2O3
Molecular Weight 140.1 g/mol
SMILES C1=C[N+](=CC=C1[N+](=O)[O-])[O-]
InChIKey RXKNNAKAVAHBNK-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-nitropyridin-1-ium-1-olate (CAS: 1124-33-0)?

4-nitropyridin-1-ium-1-olate (CAS: 1124-33-0) is a crystalline compound with a high melting point. I...

Compound Q&A

What industries use 4-nitropyridin-1-ium-1-olate (CAS: 1124-33-0)?

4-nitropyridin-1-ium-1-olate (CAS: 1124-33-0) is primarily used in pharmaceutical research for its p...

Compound Q&A

What precautions should be taken when handling 4-nitropyridin-1-ium-1-olate (CAS: 1124-33-0)?

When handling 4-nitropyridin-1-ium-1-olate (CAS: 1124-33-0), it is important to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...