Compound Q&A

What are the physical and chemical properties of 5-Nitro-2,1-benzothiazol-3-amine (CAS: 14346-19-1)?

Answer

5-Nitro-2,1-benzothiazol-3-amine
5-Nitro-2,1-benzothiazol-3-amine is a crystalline solid with a molecular weight of approximately 234.14 g/mol. It has a high solubility in polar solvents such as methanol and ethanol. The compound exhibits moderate reactivity towards nucleophiles and can be used in various organic synthesis reactions. It is also slightly soluble in water.

About

CAS No 14346-19-1
English Name 5-Nitro-2,1-benzothiazol-3-amine
Molecular Formula C7H5N3O2S
Molecular Weight 195.2 g/mol
SMILES C1=CC2=NSC(=C2C=C1[N+](=O)[O-])N
InChIKey SQBCSDZTDXLTLE-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 5-Nitro-2,1-benzothiazol-3-amine (CAS: 14346-19-1) typically synthesized?

5-Nitro-2,1-benzothiazol-3-amine can be synthesized via nitration of 2,1-benzothiazol-3-amine follow...

Compound Q&A

What industries use 5-Nitro-2,1-benzothiazol-3-amine (CAS: 14346-19-1)?

5-Nitro-2,1-benzothiazol-3-amine is used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2,1-benzothiazol-3-amine (CAS: 14346-19-1)?

When handling 5-Nitro-2,1-benzothiazol-3-amine, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...