Compound Q&A

What is (1R)-3-Methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.0~2,6~]dec-4-yl]-1-butanamine hydrochloride (CAS: 779357-85-6)?

Answer

(1R)-3-Methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.0~2,6~]dec-4-yl]-1-butanamine hydrochloride (1:1)
This compound is a complex organic molecule with a specific stereochemistry. It is a hydrochloride salt of a cyclic boronate ester derivative. It has a molecular structure that includes a borate ring, a cyclic structure, and a hydrochloride group. It is primarily used in pharmaceutical and research applications due to its unique chemical properties.

About

English Name (1R)-3-Methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.0~2,6~]dec-4-yl]-1-butanamine hydrochloride (1:1)
Molecular Formula C15H29BClNO2
Molecular Weight 301.67 g/mol
SMILES B1(OC2CC3CC(C3(C)C)C2(O1)C)C(CC(C)C)N.Cl
InChIKey XIWVZUJBIPFACB-CDVUYJLHSA-N
Last Updated: 2025-09-28 00:26

Related Q&A

Compound Q&A

What are the main uses of (1R)-3-Methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.0~2,6~]dec-4-yl]-1-butanamine hydrochloride (CAS: 779357-85-6)?

This compound is mainly used in the pharmaceutical industry as an intermediate or component in the s...

Compound Q&A

Is (1R)-3-Methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.0~2,6~]dec-4-yl]-1-butanamine hydrochloride (CAS: 779357-85-6) safe?

The compound is generally considered safe for laboratory use when handled with appropriate precautio...

Compound Q&A

How should (1R)-3-Methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.0~2,6~]dec-4-yl]-1-butanamine hydrochloride (CAS: 779357-85-6) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...