Compound Q&A

How should 9H-Fluorene-9-carboxylic acid (CAS: 1989-33-9) be stored?

Answer

9H-Fluorene-9-carboxylic acid
9H-Fluorene-9-carboxylic acid (CAS: 1989-33-9) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. Proper storage conditions help maintain its stability and minimize the risk of degradation.

About

CAS No 1989-33-9
English Name 9H-Fluorene-9-carboxylic acid
Molecular Formula C14H10O2
Molecular Weight 210.23 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)C(=O)O
InChIKey DNVJGJUGFFYUPT-UHFFFAOYSA-N
Last Updated: 2025-09-28 00:26

Related Q&A

Compound Q&A

What is 9H-Fluorene-9-carboxylic acid (CAS: 1989-33-9)?

9H-Fluorene-9-carboxylic acid (CAS: 1989-33-9) is an aromatic carboxylic acid with a molecular formu...

Compound Q&A

What are the main uses of 9H-Fluorene-9-carboxylic acid (CAS: 1989-33-9)?

9H-Fluorene-9-carboxylic acid (CAS: 1989-33-9) is widely used in the synthesis of organic compounds,...

Compound Q&A

Is 9H-Fluorene-9-carboxylic acid (CAS: 1989-33-9) safe?

9H-Fluorene-9-carboxylic acid (CAS: 1989-33-9) is generally safe when handled properly. It is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...