Compound Q&A

What are the main uses of Icosanedioic acid (CAS: 2424-92-2)?

Answer

Icosanedioic acid
Icosanedioic acid (CAS: 2424-92-2) is primarily used in the production of polyesters, particularly in the preparation of high-performance polymers. It also has applications in the pharmaceutical industry for the synthesis of certain drugs and as a stabilizer. Additionally, it is used in research for studying polymer chemistry and as a component in various chemical reactions.

About

CAS No 2424-92-2
English Name Icosanedioic acid
Molecular Formula C20H38O4
Molecular Weight 342.52 g/mol
SMILES C(CCCCCCCCCC(=O)O)CCCCCCCCC(=O)O
InChIKey JJOJFIHJIRWASH-UHFFFAOYSA-N
Last Updated: 2025-09-27 16:07

Related Q&A

Compound Q&A

What is Icosanedioic acid (CAS: 2424-92-2)?

Icosanedioic acid (CAS: 2424-92-2) is a dicarboxylic acid with the chemical formula C22H42O4. It is ...

Compound Q&A

Is Icosanedioic acid (CAS: 2424-92-2) safe?

Icosanedioic acid (CAS: 2424-92-2) is generally considered safe when handled properly. However, it s...

Compound Q&A

How should Icosanedioic acid (CAS: 2424-92-2) be stored?

Icosanedioic acid (CAS: 2424-92-2) should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...