Compound Q&A

What is 2-Amino-1,5-naphthalenedisulfonic acid (CAS: 117-62-4)?

Answer

2-Amino-1,5-naphthalenedisulfonic acid
2-Amino-1,5-naphthalenedisulfonic acid (CAS: 117-62-4) is a water-soluble organic compound with a molecular formula of C14H10N2O6S2. It is a derivative of naphthalene with two sulfonic acid groups and an amino group, commonly used in analytical chemistry for dyes and reagents.

About

CAS No 117-62-4
English Name 2-Amino-1,5-naphthalenedisulfonic acid
Molecular Formula C10H9NO6S2
Molecular Weight 303.32 g/mol
SMILES C1=CC2=C(C=CC(=C2S(=O)(=O)O)N)C(=C1)S(=O)(=O)O
InChIKey YAIKCRUPEVOINQ-UHFFFAOYSA-N
Last Updated: 2025-09-27 16:07

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-1,5-naphthalenedisulfonic acid (CAS: 117-62-4)?

2-Amino-1,5-naphthalenedisulfonic acid (CAS: 117-62-4) is primarily used in analytical chemistry as ...

Compound Q&A

Is 2-Amino-1,5-naphthalenedisulfonic acid (CAS: 117-62-4) safe?

2-Amino-1,5-naphthalenedisulfonic acid (CAS: 117-62-4) is generally considered safe for laboratory u...

Compound Q&A

How should 2-Amino-1,5-naphthalenedisulfonic acid (CAS: 117-62-4) be stored?

2-Amino-1,5-naphthalenedisulfonic acid (CAS: 117-62-4) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...