Compound Q&A

What are the main uses of 3,5-Dichlorobenzenesulfonyl chloride (CAS: 705-21-5)?

Answer

3,5-Dichlorobenzenesulfonyl chloride
3,5-Dichlorobenzenesulfonyl chloride (CAS: 705-21-5) is primarily used as an intermediate in the synthesis of pharmaceuticals and dyes. It is also used in the production of herbicides and insecticides in the agricultural industry.

About

CAS No 705-21-5
English Name 3,5-Dichlorobenzenesulfonyl chloride
Molecular Formula C6H3Cl3O2S
Molecular Weight 245.51 g/mol
SMILES C1=C(C=C(C=C1Cl)Cl)S(=O)(=O)Cl
InChIKey RJSQINMKOSOUGT-UHFFFAOYSA-N
Last Updated: 2025-09-27 16:07

Related Q&A

Compound Q&A

What is 3,5-Dichlorobenzenesulfonyl chloride (CAS: 705-21-5)?

3,5-Dichlorobenzenesulfonyl chloride (CAS: 705-21-5) is a chemical compound with a molecular formula...

Compound Q&A

Is 3,5-Dichlorobenzenesulfonyl chloride (CAS: 705-21-5) safe?

3,5-Dichlorobenzenesulfonyl chloride (CAS: 705-21-5) is not considered safe for direct human contact...

Compound Q&A

How should 3,5-Dichlorobenzenesulfonyl chloride (CAS: 705-21-5) be stored?

3,5-Dichlorobenzenesulfonyl chloride (CAS: 705-21-5) should be stored in a cool, dry place, protecte...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...