Compound Q&A

What are the main uses of 6-Hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 2164-83-2)?

Answer

6-Hydroxy-5-nitro-4(1H)-pyrimidinone
6-Hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 2164-83-2) is primarily used in research and pharmaceutical development as an intermediate or precursor in the synthesis of other compounds. It may also have potential applications in the development of new drugs or as a reagent in chemical reactions.

About

CAS No 2164-83-2
English Name 6-Hydroxy-5-nitro-4(1H)-pyrimidinone
Molecular Formula C4H3N3O4
Molecular Weight 157.08 g/mol
SMILES C1=NC(=C(C(=O)N1)[N+](=O)[O-])O
InChIKey ABTLZAVJDRUDNG-UHFFFAOYSA-N
Last Updated: 2025-09-27 16:07

Related Q&A

Compound Q&A

What is 6-Hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 2164-83-2)?

6-Hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 2164-83-2) is a pyrimidine derivative with a hydroxyl gro...

Compound Q&A

Is 6-Hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 2164-83-2) safe?

6-Hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 2164-83-2) is generally considered safe when handled with...

Compound Q&A

How should 6-Hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 2164-83-2) be stored?

6-Hydroxy-5-nitro-4(1H)-pyrimidinone (CAS: 2164-83-2) should be stored in a cool, dry place at a tem...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...