Compound Q&A

What are the main uses of 2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid (CAS: 376591-95-6)?

Answer

2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid
2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid is mainly used in research and development for its structural and chemical properties. It is utilized in various applications including pharmaceuticals, materials science, and analytical chemistry due to its reactivity and stability.

About

English Name 2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid
Molecular Formula C13H9NO5
Molecular Weight 259.22 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=C(C(=CC=C2)[N+](=O)[O-])O
InChIKey JCFPSTQCDAZKJN-UHFFFAOYSA-N
Last Updated: 2025-09-27 16:07

Related Q&A

Compound Q&A

What is 2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid (CAS: 376591-95-6)?

2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid, also known as 2-hydroxy-3-nitro-3-biphenylcarboxylic ...

Compound Q&A

Is 2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid (CAS: 376591-95-6) safe?

2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid is generally safe when handled with proper precautions...

Compound Q&A

How should 2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid (CAS: 376591-95-6) be stored?

2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid should be stored in a cool, dark, and dry place to pre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...