Compound Q&A

Are there alternatives to Monomethyl Auristatin F (CAS: 745017-94-1) in synthesis?

Answer

Monomethyl Auristatin F
Monomethyl Auristatin F (MMAF) is a potent cytotoxic agent but alternatives such as monomethyl auristatin E (MMAE) and pyrrolobenzodiazepines (PBDs) are used in some synthesis processes. These alternatives offer similar anti-cancer properties and can be used as substitutes depending on the specific requirements of the synthesis and the desired pharmacological profile.

About

English Name Monomethyl Auristatin F
Molecular Formula C39H65N5O8
Molecular Weight 731.98 g/mol
SMILES CN[C@H](C(=O)N[C@H](C(=O)N(C([C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)C)OC)OC)[C@H](CC)C)C)C(C)C)C(C)C
InChIKey MFRNYXJJRJQHNW-DEMKXPNLSA-N
Last Updated: 2025-09-27 00:43

Related Q&A

Compound Q&A

What regulatory guidelines apply to Monomethyl Auristatin F (CAS: 745017-94-1)?

Monomethyl Auristatin F (MMAF) is subject to various regulatory guidelines. In Europe, it must compl...

Compound Q&A

What is the market or research trend for Monomethyl Auristatin F (CAS: 745017-94-1)?

Monomethyl Auristatin F (MMAF) is increasingly being researched for its potential in cancer therapy,...

Compound Q&A

How should waste containing Monomethyl Auristatin F (CAS: 745017-94-1) be handled?

Waste containing Monomethyl Auristatin F (MMAF) must be handled with extreme caution due to its toxi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...