Compound Q&A

Are there alternatives to 7-Bromo-3,4-dihydro-1(2H)-naphthalenone in synthesis?

Answer

7-Bromo-3,4-dihydro-1(2H)-naphthalenone
There are alternative reagents and compounds that can be used in the synthesis of 7-Bromo-3,4-dihydro-1(2H)-naphthalenone (CAS: 32281-97-3). For example, bromination of 3,4-dihydro-1(2H)-naphthalenone with other brominating agents such as N-bromosuccinimide (NBS) or N-iodosuccinimide (NIS) can be explored. Additionally, isomers of the compound or structurally similar naphthalenone derivatives can serve as viable alternatives, depending on the specific requirements of the synthesis. These alternatives can provide similar properties while offering different functional groups or reactivity profiles.

About

CAS No 32281-97-3
English Name 7-Bromo-3,4-dihydro-1(2H)-naphthalenone
Molecular Formula C10H9BrO
Molecular Weight 225.08 g/mol
SMILES C1CC2=C(C=C(C=C2)Br)C(=O)C1
InChIKey YGVDCGFUUUJCDF-UHFFFAOYSA-N
Last Updated: 2025-09-27 00:43

Related Q&A

Compound Q&A

What regulatory guidelines apply to 7-Bromo-3,4-dihydro-1(2H)-naphthalenone (CAS: 32281-97-3)?

The compound 7-Bromo-3,4-dihydro-1(2H)-naphthalenone (CAS: 32281-97-3) is subject to various regulat...

Compound Q&A

What is the market or research trend for 7-Bromo-3,4-dihydro-1(2H)-naphthalenone?

The market and research trends for 7-Bromo-3,4-dihydro-1(2H)-naphthalenone (CAS: 32281-97-3) are clo...

Compound Q&A

How should waste containing 7-Bromo-3,4-dihydro-1(2H)-naphthalenone be handled?

Waste containing 7-Bromo-3,4-dihydro-1(2H)-naphthalenone (CAS: 32281-97-3) should be handled in acco...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...