Compound Q&A

What is the market or research trend for 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride (CAS: 171058-17-6)?

Answer

3-Hexyl-1-methyl-1H-imidazol-3-ium chloride
The market for 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride is growing due to its use in various applications such as electrochemical devices and as a cationic surfactant. Research trends focus on its properties as an electrolyte and its potential in new technologies like batteries and sensors.

About

English Name 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride
Molecular Formula C10H19ClN2
Molecular Weight 202.72 g/mol
SMILES CCCCCCN1C=C[N+](=C1)C.[Cl-]
InChIKey NKRASMXHSQKLHA-UHFFFAOYSA-M
Last Updated: 2025-09-26 14:59

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride (CAS: 171058-17-6)?

3-Hexyl-1-methyl-1H-imidazol-3-ium chloride (CAS: 171058-17-6) should comply with the Globally Harmo...

Compound Q&A

Are there alternatives to 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride (CAS: 171058-17-6) in synthesis?

Alternatives to 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride include other imidazolium compounds with...

Compound Q&A

How should waste containing 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride (CAS: 171058-17-6) be handled?

Waste containing 3-Hexyl-1-methyl-1H-imidazol-3-ium chloride should be collected in appropriate cont...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...