Compound Q&A

Are there alternatives to Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide (CAS: 189114-61-2) in synthesis?

Answer

Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide
Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide (CAS: 189114-61-2) can be replaced by similar silver complexes such as silver triflate or silver hexafluorophosphate. These alternatives are often used in organic synthesis due to their similar properties and reactivity profiles, making them suitable substitutes for specific reactions.

About

English Name Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide
Molecular Formula C2AgF6NO4S2
Molecular Weight 388.01 g/mol
SMILES FC(S1(=O)=[O][Ag+][O]=S(=O)([N-]1)C(F)(F)F)(F)F
InChIKey HSYLTRBDKXZSGS-UHFFFAOYSA-N
Last Updated: 2025-09-26 14:59

Related Q&A

Compound Q&A

What regulatory guidelines apply to Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide (CAS: 189114-61-2)?

Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide (CAS: 189114-61-2) falls under various regulatory g...

Compound Q&A

What is the market or research trend for Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide (CAS: 189114-61-2)?

Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide (CAS: 189114-61-2) is a key reagent in the field of...

Compound Q&A

How should waste containing Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide (CAS: 189114-61-2) be handled?

Waste containing Silver(1+) bis[(trifluoromethyl)sulfonyl]azanide (CAS: 189114-61-2) should be colle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...