Compound Q&A

Are there alternatives to 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate in synthesis?

Answer

4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate
While 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate is a specific reagent used in various chemical syntheses, there are alternatives such as other piperidinedicarboxylates or related compounds. Common substitution includes using simpler carboxylic acid derivatives or other functionalized piperidines. These alternatives can offer similar reactivity and functionality, making them viable options depending on the specific synthesis requirements.

About

English Name 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate
Molecular Formula C12H21NO4
Molecular Weight 243.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)C(=O)OC
InChIKey PTZNCCIULVXFIJ-UHFFFAOYSA-N
Last Updated: 2025-09-26 07:28

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate (CAS: 124443-68-1)?

4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate (CAS: 124443-68-1) is regulated under t...

Compound Q&A

What is the market or research trend for 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate?

The market for 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate (CAS: 124443-68-1) is dr...

Compound Q&A

How should waste containing 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate (CAS: 124443-68-1) be handled?

Waste containing 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate (CAS: 124443-68-1) sho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...