Compound Q&A

Are there alternatives to Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (CAS: 482577-59-3) in synthesis?

Answer

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (1:1)
In the synthesis of Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (CAS: 482577-59-3), alternative reagents such as other valinate derivatives or similar cyano-substituted biphenyl compounds can be explored. Isomers and analogs like Methyl N-[(3'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride can be considered depending on the specific reaction conditions and desired product properties. These alternatives can offer similar functionalities but with potentially different synthetic pathways and cost-efficiencies.

About

English Name Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (1:1)
Molecular Formula C20H23ClN2O2
Molecular Weight 311.43 g/mol
SMILES CC(C)C(C(=O)OC)NCC1=CC=C(C=C1)C2=CC=CC=C2C#N.Cl
InChIKey AZQXUWUZQLZNIM-FYZYNONXSA-N
Last Updated: 2025-09-26 07:28

Related Q&A

Compound Q&A

What regulatory guidelines apply to Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (CAS: 482577-59-3)?

Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (CAS: 482577-59-3) is subject to r...

Compound Q&A

What is the market or research trend for Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (CAS: 482577-59-3)?

The market and research trends for Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride...

Compound Q&A

How should waste containing Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (CAS: 482577-59-3) be handled?

Waste containing Methyl N-[(2'-cyano-4-biphenylyl)methyl]-L-valinate hydrochloride (CAS: 482577-59-3...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...