Compound Q&A

What are the physical and chemical properties of (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid (CAS: 2488-15-5)?

Answer

(2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid
(2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid is a white crystalline solid with a molecular weight of approximately 298.39 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. The compound is known for its stability and low reactivity under normal conditions, making it suitable for various chemical transformations. It has a pKa of around 8.5, indicating basic properties.

About

CAS No 2488-15-5
English Name (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid
Molecular Formula C10H19NO4S
Molecular Weight 249.33 g/mol
SMILES CC(C)(C)OC(=O)NC(CCSC)C(=O)O
InChIKey IMUSLIHRIYOHEV-ZETCQYMHSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid (CAS: 2488-15-5) typically synthesized?

(2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid is typically synthesized via a...

Compound Q&A

What industries use (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid (CAS: 2488-15-5)?

(2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid (CAS: 2488-15-5)?

When handling (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-(methylsulfanyl)butanoic acid (CAS: 2488-15-5)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...