Compound Q&A

What industries use 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene (CAS: 130723-13-6)?

Answer

1-Bromo-3-fluoro-5-(trifluoromethyl)benzene
1-Bromo-3-fluoro-5-(trifluoromethyl)benzene is primarily used in the pharmaceutical and polymer industries. It serves as a precursor for the synthesis of various fluorinated compounds and is employed in the development of new materials with specific electronic and mechanical properties. Additionally, it is used in the manufacturing of sensors and semiconductors due to its unique chemical structure.

About

English Name 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene
Molecular Formula C7H3BrF4
Molecular Weight 242.99699999999999 g/mol
SMILES C1=C(C=C(C=C1F)Br)C(F)(F)F
InChIKey LIGBGEJPUQBLTG-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene (CAS: 130723-13-6)?

1-Bromo-3-fluoro-5-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene (CAS: 130723-13-6) typically synthesized?

1-Bromo-3-fluoro-5-(trifluoromethyl)benzene can be synthesized via bromination of 3-fluoro-5-(triflu...

Compound Q&A

What precautions should be taken when handling 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene (CAS: 130723-13-6)?

When handling 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene, it is essential to use appropriate person...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...