Compound Q&A

How is 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene (CAS: 130723-13-6) typically synthesized?

Answer

1-Bromo-3-fluoro-5-(trifluoromethyl)benzene
1-Bromo-3-fluoro-5-(trifluoromethyl)benzene can be synthesized via bromination of 3-fluoro-5-(trifluoromethyl)benzene using N-bromosuccinimide (NBS) in the presence of a radical initiator like benzoyl peroxide. The reaction involves the formation of a highly substituted benzene ring with a bromine, fluoro, and trifluoromethyl group, providing high selectivity and yield.

About

English Name 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene
Molecular Formula C7H3BrF4
Molecular Weight 242.99699999999999 g/mol
SMILES C1=C(C=C(C=C1F)Br)C(F)(F)F
InChIKey LIGBGEJPUQBLTG-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene (CAS: 130723-13-6)?

1-Bromo-3-fluoro-5-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene (CAS: 130723-13-6)?

1-Bromo-3-fluoro-5-(trifluoromethyl)benzene is primarily used in the pharmaceutical and polymer indu...

Compound Q&A

What precautions should be taken when handling 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene (CAS: 130723-13-6)?

When handling 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene, it is essential to use appropriate person...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...