Compound Q&A

What are the physical and chemical properties of 3,5-Di-tert-butylphenol (CAS: 1138-52-9)?

Answer

3,5-Di-tert-butylphenol
3,5-Di-tert-butylphenol (CAS: 1138-52-9) is a white crystalline solid with a molecular weight of approximately 258.43 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong acids or bases. It is used in the synthesis of other compounds and in the formulation of various commercial products.

About

CAS No 1138-52-9
English Name 3,5-Di-tert-butylphenol
Molecular Formula C14H22O
Molecular Weight 206.33 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1)O)C(C)(C)C
InChIKey ZDWSNKPLZUXBPE-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 3,5-Di-tert-butylphenol (CAS: 1138-52-9) typically synthesized?

3,5-Di-tert-butylphenol (CAS: 1138-52-9) is typically synthesized via the reduction of 3,5-dibromo-2...

Compound Q&A

What industries use 3,5-Di-tert-butylphenol (CAS: 1138-52-9)?

3,5-Di-tert-butylphenol (CAS: 1138-52-9) is widely used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 3,5-Di-tert-butylphenol (CAS: 1138-52-9)?

When handling 3,5-Di-tert-butylphenol (CAS: 1138-52-9), it is essential to wear protective gloves, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...