Compound Q&A

How is 8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one (CAS: 110683-22-2) typically synthesized?

Answer

8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one
8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one can be synthesized using a multi-step procedure involving the condensation of a chromenone derivative with 5-aminotetrazole. The reaction is typically carried out in an aprotic solvent like DMF, with a coupling agent such as EDC. The yield and selectivity of the reaction can be optimized by adjusting the reaction conditions and using appropriate catalysts.

About

English Name 8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one
Molecular Formula C10H7N5O2
Molecular Weight 229.2 g/mol
SMILES c1cc2c(=O)cc(oc2c(c1)N)c3[nH]nnn3
InChIKey GSZQAIJMONCDFZ-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one (CAS: 110683-22-2)?

8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one is a crystalline compound with a molecular weight of a...

Compound Q&A

What industries use 8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one (CAS: 110683-22-2)?

8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one finds applications in various industries, including ph...

Compound Q&A

What precautions should be taken when handling 8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one (CAS: 110683-22-2)?

When handling 8-Amino-2-(1H-tetrazol-5-yl)-4H-chromen-4-one, proper personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...