Compound Q&A

How is Abemaciclib Impurity 1 (CAS: 1231930-33-8) typically synthesized?

Answer

Abemaciclib Impurity 1
Abemaciclib Impurity 1 is typically synthesized via a multi-step process involving the protection of a carboxylic acid, followed by amide formation, esterification, and subsequent deprotection. Common catalysts include acids like hydrochloric acid, and the process yields a high purity product with good selectivity. The exact steps and conditions vary depending on the starting materials and specific impurity profile.

About

English Name Abemaciclib Impurity 1
Molecular Formula C11H12BrFN2
Molecular Weight 271.13 g/mol
SMILES CC1=NC2=C(N1C(C)C)C=C(C=C2F)Br
InChIKey SJQZRZLUEGCXFN-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Abemaciclib Impurity 1 (CAS: 1231930-33-8)?

Abemaciclib Impurity 1 is a crystalline solid with a molecular weight of approximately 565.6 g/mol. ...

Compound Q&A

What industries use Abemaciclib Impurity 1 (CAS: 1231930-33-8)?

Abemaciclib Impurity 1 is primarily used in the pharmaceutical industry as a quality control referen...

Compound Q&A

What precautions should be taken when handling Abemaciclib Impurity 1 (CAS: 1231930-33-8)?

When handling Abemaciclib Impurity 1, appropriate Personal Protective Equipment (PPE) such as gloves...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...