Compound Q&A

What industries use N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3)?

Answer

N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride
N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3) finds applications in various industries. In the pharmaceutical industry, it is used as a precursor in the synthesis of certain drugs. In polymer science, it serves as a cross-linking agent for silane-modified polymers. Additionally, it is used in the development of sensor materials and semiconductor applications due to its unique chemical properties and reactivity.

About

CAS No 34937-00-3
English Name N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride
Molecular Formula C17H31ClN2O3Si
Molecular Weight 374.9850000000002 g/mol
EINECS 252-297-3
SMILES CO[Si](OC)(CCCN(C/C=C/C1=CC=CC=C1)CCN)OC.[H]Cl
InChIKey MYWJOHLSXLTXCV-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3)?

N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3) is a di...

Compound Q&A

How is N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3) typically synthesized?

N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3) is synt...

Compound Q&A

What precautions should be taken when handling N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3)?

When handling N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...