Compound Q&A

How is N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3) typically synthesized?

Answer

N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride
N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3) is synthesized through the reaction of cinnamylamine and 3-(trimethoxysilyl)propyl ethylene diamine. The process involves the condensation of these two amines in the presence of a phase transfer catalyst like tetrabutylammonium bromide at an appropriate temperature and pressure. The yield can be enhanced by optimizing the reaction conditions, including the choice of solvent and temperature. The product is typically isolated by precipitation, filtration, and drying.

About

CAS No 34937-00-3
English Name N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride
Molecular Formula C17H31ClN2O3Si
Molecular Weight 374.9850000000002 g/mol
EINECS 252-297-3
SMILES CO[Si](OC)(CCCN(C/C=C/C1=CC=CC=C1)CCN)OC.[H]Cl
InChIKey MYWJOHLSXLTXCV-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3)?

N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3) is a di...

Compound Q&A

What industries use N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3)?

N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3) finds a...

Compound Q&A

What precautions should be taken when handling N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937-00-3)?

When handling N1-Cinnamyl-N1-(3-(trimethoxysilyl)propyl)ethane-1,2-diamine hydrochloride (CAS: 34937...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...