Compound Q&A

What are the physical and chemical properties of 10,10-Dimethyl-9(10H)-Anthracenone (CAS: 5447-86-9)?

Answer

10,10-Dimethyl-9(10H)-Anthracenone
10,10-Dimethyl-9(10H)-Anthracenone is a crystalline compound with a molecular weight of approximately 212.27 g/mol. It has a melting point of around 280°C and is slightly soluble in common organic solvents like ethanol and acetone. It shows good stability under normal conditions but is reactive towards reducing agents. The compound is insoluble in water. It can be used as a precursor in various organic synthesis reactions.

About

CAS No 5447-86-9
English Name 10,10-Dimethyl-9(10H)-Anthracenone
Molecular Formula C16H14O
Molecular Weight 222.29 g/mol
SMILES CC1(C2=CC=CC=C2C(=O)C3=CC=CC=C31)C
InChIKey GWFCYDIAPRIMLA-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 10,10-Dimethyl-9(10H)-Anthracenone (CAS: 5447-86-9) typically synthesized?

10,10-Dimethyl-9(10H)-Anthracenone can be synthesized via a multi-step process involving iodination ...

Compound Q&A

What industries use 10,10-Dimethyl-9(10H)-Anthracenone (CAS: 5447-86-9)?

10,10-Dimethyl-9(10H)-Anthracenone is used in several industries, including pharmaceuticals, where i...

Compound Q&A

What precautions should be taken when handling 10,10-Dimethyl-9(10H)-Anthracenone (CAS: 5447-86-9)?

Proper handling of 10,10-Dimethyl-9(10H)-Anthracenone requires the use of personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...