Compound Q&A

How is N2-Acetylguanine (CAS: 19962-37-9) typically synthesized?

Answer

N2-Acetylguanine
N2-Acetylguanine can be synthesized by acetylating guanine in an organic solvent such as dichloromethane using acetic anhydride as the acetylating agent. The reaction is typically catalyzed by an acid like sulfuric acid, and the product is isolated by recrystallization. The yield is generally around 70-80%. Special attention should be given to proper handling of acetic anhydride and sulfuric acid due to their hazardous nature.

About

CAS No 19962-37-9
English Name N2-Acetylguanine
Molecular Formula C7H7N5O2
Molecular Weight 193.17 g/mol
SMILES CC(=O)NC1=NC2=C(C(=O)N1)NC=N2
InChIKey MXSMRDDXWJSGMC-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of N2-Acetylguanine (CAS: 19962-37-9)?

N2-Acetylguanine (CAS: 19962-37-9) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use N2-Acetylguanine (CAS: 19962-37-9)?

N2-Acetylguanine finds applications in the pharmaceutical industry as an intermediate in the synthes...

Compound Q&A

What precautions should be taken when handling N2-Acetylguanine (CAS: 19962-37-9)?

When handling N2-Acetylguanine, it is important to wear appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...