Compound Q&A

What precautions should be taken when handling (3S)-4-[(2-Methyl-2-propanyl)oxy]-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 34582-32-6)?

Answer

(3S)-4-[(2-Methyl-2-propanyl)oxy]-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
When handling (3S)-4-[(2-Methyl-2-propanyl)oxy]-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid, use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood. In case of a spill, follow the safety data sheet (SDS) guidelines for clean-up and disposal. Ensure proper storage in a cool, dry place away from direct sunlight and heat sources.

About

CAS No 34582-32-6
English Name (3S)-4-[(2-Methyl-2-propanyl)oxy]-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
Molecular Formula C13H23NO6
Molecular Weight 289.33 g/mol
SMILES CC(C)(C)OC(=O)C(CC(=O)O)NC(=O)OC(C)(C)C
InChIKey RAUQRYTYJIYLTF-QMMMGPOBSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-4-[(2-Methyl-2-propanyl)oxy]-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 34582-32-6)?

The compound (3S)-4-[(2-Methyl-2-propanyl)oxy]-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobu...

Compound Q&A

How is (3S)-4-[(2-Methyl-2-propanyl)oxy]-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 34582-32-6) typically synthesized?

This compound is typically synthesized through a multistep process involving esterification, amidati...

Compound Q&A

What industries use (3S)-4-[(2-Methyl-2-propanyl)oxy]-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 34582-32-6)?

This compound is used in the pharmaceutical industry for the synthesis of complex organic molecules....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...