Compound Q&A

How is 1H-Benzo[de]isoquinoline-1,3(2H)-dione (CAS: 81-83-4) typically synthesized?

Answer

1H-Benzo[de]isoquinoline-1,3(2H)-dione
1H-Benzo[de]isoquinoline-1,3(2H)-dione is usually synthesized via the oxidative cleavage of 2,3-dihydro-1H-benzo[de]isoquinoline or by the condensation of 1,3-diketone with 1H-benzo[de]isoquinoline. The synthesis often involves the use of reagents like p-toluenesulfonic acid or potassium permanganate, with yields typically ranging from 50% to 70%. The method is selective and efficient.

About

CAS No 81-83-4
English Name 1H-Benzo[de]isoquinoline-1,3(2H)-dione
Molecular Formula C12H7NO2
Molecular Weight 197.19 g/mol
SMILES O=C1NC(=O)c2cccc3cccc1c23
InChIKey XJHABGPPCLHLLV-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-Benzo[de]isoquinoline-1,3(2H)-dione (CAS: 81-83-4)?

1H-Benzo[de]isoquinoline-1,3(2H)-dione is a crystalline solid with a molecular weight of 194.17 g/mo...

Compound Q&A

What industries use 1H-Benzo[de]isoquinoline-1,3(2H)-dione (CAS: 81-83-4)?

1H-Benzo[de]isoquinoline-1,3(2H)-dione is widely used in the pharmaceutical industry due to its bioa...

Compound Q&A

What precautions should be taken when handling 1H-Benzo[de]isoquinoline-1,3(2H)-dione (CAS: 81-83-4)?

When handling 1H-Benzo[de]isoquinoline-1,3(2H)-dione, it is advisable to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...