Compound Q&A

What are the physical and chemical properties of Nickel(2+) 2,2'-sulfanediylbis[4-(2,4,4-trimethyl-2-pentanyl)phenolate] 1-butanamine (CAS: 14516-71-3)?

Answer

Nickel(2+) 2,2'-sulfanediylbis[4-(2,4,4-trimethyl-2-pentanyl)phenolate] 1-butanamine (1:1:1)
This compound is a complex nickel salt with a crystalline form. It has a high molecular weight and low solubility in water. It exhibits moderate reactivity towards various metal ions and can form stable complexes. Additionally, it has useful spectroscopic properties, making it valuable for analytical chemistry applications.

About

CAS No 14516-71-3
English Name Nickel(2+) 2,2'-sulfanediylbis[4-(2,4,4-trimethyl-2-pentanyl)phenolate] 1-butanamine (1:1:1)
Molecular Formula C32H51NNiO2S
Molecular Weight 572.5 g/mol
SMILES CCCCN.CC(C)(C)CC(C)(C)C1=CC(=C(C=C1)[O-])SC2=C(C=CC(=C2)C(C)(C)CC(C)(C)C)[O-].[Ni+2]
InChIKey DPLLDVMBMPQDCO-UHFFFAOYSA-L
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Nickel(2+) 2,2'-sulfanediylbis[4-(2,4,4-trimethyl-2-pentanyl)phenolate] 1-butanamine (CAS: 14516-71-3) typically synthesized?

This compound can be synthesized by the stepwise reaction of nickel(II) acetate with 2,2'-sulfanediy...

Compound Q&A

What industries use Nickel(2+) 2,2'-sulfanediylbis[4-(2,4,4-trimethyl-2-pentanyl)phenolate] 1-butanamine (CAS: 14516-71-3)?

This compound finds applications in various industries, including pharmaceuticals and polymers. It i...

Compound Q&A

What precautions should be taken when handling Nickel(2+) 2,2'-sulfanediylbis[4-(2,4,4-trimethyl-2-pentanyl)phenolate] 1-butanamine (CAS: 14516-71-3)?

When handling this compound, appropriate personal protective equipment (PPE) should be worn, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...