Compound Q&A

How is Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 76757-90-9) typically synthesized?

Answer

Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate
Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate is synthesized via a multi-step process involving the carbonylation of 2-methyl-2-propanol with tyrosine. The reaction typically requires the use of a suitable catalyst and is carried out under specific temperature and pressure conditions. The overall yield can be around 70-80%, with the main challenges being the selectivity and the stability of the intermediate compounds during the process.

About

CAS No 76757-90-9
English Name Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate
Molecular Formula C15H21NO5
Molecular Weight 295.34 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)OC
InChIKey NQIFXJSLCUJHBB-GFCCVEGCSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 76757-90-9)?

Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate is a white crystalline powder with a molecul...

Compound Q&A

What industries use Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 76757-90-9)?

Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 76757-90-9)?

When handling Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 76757-90-9), it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...