Compound Q&A

How is 2,6-Dibromonaphthalene (CAS: 13720-06-4) typically synthesized?

Answer

2,6-Dibromonaphthalene
2,6-Dibromonaphthalene is usually synthesized through the bromination of naphthalene. This process typically involves the use of bromine in the presence of a Lewis acid catalyst such as aluminum bromide or iron(III) bromide. The reaction is conducted under anhydrous conditions to prevent side reactions.

About

CAS No 13720-06-4
English Name 2,6-Dibromonaphthalene
Molecular Formula C10H6Br2
Molecular Weight 285.966 g/mol
SMILES C1=CC2=C(C=CC(=C2)Br)C=C1Br
InChIKey PJZDEYKZSZWFPX-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dibromonaphthalene (CAS: 13720-06-4)?

2,6-Dibromonaphthalene is a crystalline solid with a molecular weight of approximately 326.04 g/mol....

Compound Q&A

What industries use 2,6-Dibromonaphthalene (CAS: 13720-06-4)?

2,6-Dibromonaphthalene is primarily used in the chemical industry for the production of dyes, pigmen...

Compound Q&A

What precautions should be taken when handling 2,6-Dibromonaphthalene (CAS: 13720-06-4)?

When handling 2,6-Dibromonaphthalene, appropriate personal protective equipment (PPE) such as gloves...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...