Compound Q&A

What are the physical and chemical properties of 2,6-Dibromonaphthalene (CAS: 13720-06-4)?

Answer

2,6-Dibromonaphthalene
2,6-Dibromonaphthalene is a crystalline solid with a molecular weight of approximately 326.04 g/mol. It has limited solubility in water but is soluble in organic solvents like benzene and chloroform. Chemically, it is relatively stable but can react with reducing agents. Its melting point is around 275°C and boiling point is approximately 370°C.

About

CAS No 13720-06-4
English Name 2,6-Dibromonaphthalene
Molecular Formula C10H6Br2
Molecular Weight 285.966 g/mol
SMILES C1=CC2=C(C=CC(=C2)Br)C=C1Br
InChIKey PJZDEYKZSZWFPX-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 2,6-Dibromonaphthalene (CAS: 13720-06-4) typically synthesized?

2,6-Dibromonaphthalene is usually synthesized through the bromination of naphthalene. This process t...

Compound Q&A

What industries use 2,6-Dibromonaphthalene (CAS: 13720-06-4)?

2,6-Dibromonaphthalene is primarily used in the chemical industry for the production of dyes, pigmen...

Compound Q&A

What precautions should be taken when handling 2,6-Dibromonaphthalene (CAS: 13720-06-4)?

When handling 2,6-Dibromonaphthalene, appropriate personal protective equipment (PPE) such as gloves...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...