Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate (CAS: 79069-14-0)?

Answer

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate
2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate is a liquid at room temperature with a molecular weight of approximately 174.24 g/mol. It is slightly soluble in water but miscible with organic solvents. Chemically, it is relatively stable but can react with strong acids to form the corresponding amide. It has a characteristic odor and boiling point around 90-95°C. It is sensitive to moisture and should be stored in a dry environment.

About

CAS No 79069-14-0
English Name 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate
Molecular Formula C10H21NO3
Molecular Weight 203.28 g/mol
SMILES CC(C)C(CO)NC(=O)OC(C)(C)C
InChIKey OOQRRYDVICNJGC-MRVPVSSYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate (CAS: 79069-14-0) typically synthesized?

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate is synthesized by the reaction betw...

Compound Q&A

What industries use 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate (CAS: 79069-14-0)?

2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate is used in various industries, part...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate (CAS: 79069-14-0)?

When handling 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate, it is crucial to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...