Compound Q&A

How is 4,6-Dibromodibenzofuran (CAS: 201138-91-2) typically synthesized?

Answer

4,6-Dibromodibenzofuran
4,6-Dibromodibenzofuran can be synthesized through the bromination of dibenzofuran using bromine in the presence of a Lewis acid catalyst, such as aluminum bromide. The reaction yields 4,6-dibromodibenzofuran in moderate to good selectivity and yield, typically requiring purification techniques like column chromatography for isolation.

About

English Name 4,6-Dibromodibenzofuran
Molecular Formula C12H6Br2O
Molecular Weight 325.987 g/mol
SMILES C1=CC2=C(C(=C1)Br)OC3=C2C=CC=C3Br
InChIKey XSJLDNSNUICSQC-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,6-Dibromodibenzofuran (CAS: 201138-91-2)?

4,6-Dibromodibenzofuran (CAS: 201138-91-2) is a solid with a crystalline form. It has a high molecul...

Compound Q&A

What industries use 4,6-Dibromodibenzofuran (CAS: 201138-91-2)?

4,6-Dibromodibenzofuran is used in various industries, including pharmaceuticals, where it serves as...

Compound Q&A

What precautions should be taken when handling 4,6-Dibromodibenzofuran (CAS: 201138-91-2)?

When handling 4,6-Dibromodibenzofuran (CAS: 201138-91-2), laboratory technicians should wear appropr...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...