Compound Q&A

What industries use Potassium 1-carboxyvinyl hydrogen phosphate (CAS: 4265-07-0)?

Answer

Potassium 1-carboxyvinyl hydrogen phosphate
Potassium 1-carboxyvinyl hydrogen phosphate (CAS: 4265-07-0) is widely used in pharmaceuticals, where it serves as a stabilizer and buffer. It is also utilized in the polymer industry for the synthesis of certain types of plastics and elastomers. Additionally, this compound finds applications in the production of sensors and semiconductors due to its unique chemical and physical properties.

About

CAS No 4265-07-0
English Name Potassium 1-carboxyvinyl hydrogen phosphate
Molecular Formula C3H4KO6P
Molecular Weight 206.13 g/mol
SMILES C=C(C(=O)O)OP(=O)(O)[O-].[K+]
InChIKey SOSDSEAIODNVPX-UHFFFAOYSA-M
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Potassium 1-carboxyvinyl hydrogen phosphate (CAS: 4265-07-0)?

Potassium 1-carboxyvinyl hydrogen phosphate (CAS: 4265-07-0) is a white crystalline powder with a mo...

Compound Q&A

How is Potassium 1-carboxyvinyl hydrogen phosphate (CAS: 4265-07-0) typically synthesized?

Potassium 1-carboxyvinyl hydrogen phosphate (CAS: 4265-07-0) is typically synthesized by reacting po...

Compound Q&A

What precautions should be taken when handling Potassium 1-carboxyvinyl hydrogen phosphate (CAS: 4265-07-0)?

When handling Potassium 1-carboxyvinyl hydrogen phosphate (CAS: 4265-07-0), it is essential to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...