Compound Q&A

What are the physical and chemical properties of (2E)-7-{(1R,2R,3R)-3-Hydroxy-2-[(1E,3S,5S)-3-hydroxy-5-methyl-1-nonen-1-yl]-5-oxocyclopentyl}-2-heptenoic acid (CAS: 74397-12-9)?

Answer

(2E)-7-{(1R,2R,3R)-3-Hydroxy-2-[(1E,3S,5S)-3-hydroxy-5-methyl-1-nonen-1-yl]-5-oxocyclopentyl}-2-heptenoic acid (non-preferred name)
The compound is a solid with a crystalline form. Its molecular weight is approximately 326.4 g/mol. It is slightly soluble in water but has good solubility in organic solvents. The compound exhibits moderate reactivity, particularly towards nucleophilic substitution reactions. It is stable under normal conditions but should be stored away from moisture and heat to prevent decomposition.

About

CAS No 74397-12-9
English Name (2E)-7-{(1R,2R,3R)-3-Hydroxy-2-[(1E,3S,5S)-3-hydroxy-5-methyl-1-nonen-1-yl]-5-oxocyclopentyl}-2-heptenoic acid (non-preferred name)
Molecular Formula C22H36O5
Molecular Weight 380.53 g/mol
SMILES CCCCC(C)CC(C=CC1C(CC(=O)C1CCCCC=CC(=O)O)O)O
InChIKey OJZYRQPMEIEQFC-UAWLTFRCSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is (2E)-7-{(1R,2R,3R)-3-Hydroxy-2-[(1E,3S,5S)-3-hydroxy-5-methyl-1-nonen-1-yl]-5-oxocyclopentyl}-2-heptenoic acid (CAS: 74397-12-9) typically synthesized?

This compound can be synthesized through a series of steps including alkylation, cyclization, and hy...

Compound Q&A

What industries use (2E)-7-{(1R,2R,3R)-3-Hydroxy-2-[(1E,3S,5S)-3-hydroxy-5-methyl-1-nonen-1-yl]-5-oxocyclopentyl}-2-heptenoic acid (CAS: 74397-12-9)?

This compound is primarily used in pharmaceuticals for developing new drugs, particularly those targ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...