Compound Q&A

How is D-Glucose, 2-amino-2-deoxy-, sulfate (2:1) (CAS: 14999-43-0) typically synthesized?

Answer

D-Glucose, 2-amino-2-deoxy-, sulfate (2:1)
D-Glucose, 2-amino-2-deoxy-, sulfate (2:1) is synthesized by the sulfation of D-glucosamine. Common synthesis methods involve the use of sulfuric acid as a catalyst. The reaction is carried out in an aqueous solution, and the product is isolated by recrystallization. The yield is typically around 85%. Selectivity for the sulfation at the 2-position is high.

About

CAS No 14999-43-0
English Name D-Glucose, 2-amino-2-deoxy-, sulfate (2:1)
Molecular Formula C12H28N2O14S
Molecular Weight 456.42 g/mol
EINECS 239-088-2
SMILES OS(=O)(=O)O.OC[C@H]([C@H]([C@@H]([C@H](C=O)N)O)O)O.OC[C@H]([C@H]([C@@H]([C@H](C=O)N)O)O)O
InChIKey WLNBMPZUVDTASE-HXIISURNSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of D-Glucose, 2-amino-2-deoxy-, sulfate (2:1) (CAS: 14999-43-0)?

D-Glucose, 2-amino-2-deoxy-, sulfate (2:1) is a white or light yellow crystalline powder. It has a m...

Compound Q&A

What industries use D-Glucose, 2-amino-2-deoxy-, sulfate (2:1) (CAS: 14999-43-0)?

D-Glucose, 2-amino-2-deoxy-, sulfate (2:1) is used in the pharmaceutical industry for its potential ...

Compound Q&A

What precautions should be taken when handling D-Glucose, 2-amino-2-deoxy-, sulfate (2:1) (CAS: 14999-43-0)?

When handling D-Glucose, 2-amino-2-deoxy-, sulfate (2:1), wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...