Compound Q&A

What are the physical and chemical properties of Zinc diacrylate (CAS: 14643-87-9)?

Answer

Zinc diacrylate
Zinc diacrylate (CAS: 14643-87-9) is a colorless to slightly yellow liquid with a low molecular weight. It has a high reactivity due to the acrylate groups, making it suitable for crosslinking reactions. The compound has a low solubility in water but is soluble in organic solvents like ethanol and acetone. Its molecular weight is approximately 210 g/mol.

About

CAS No 14643-87-9
English Name Zinc diacrylate
Molecular Formula C6H6O4Zn
Molecular Weight 207.5 g/mol
SMILES C=CC(=O)[O-].C=CC(=O)[O-].[Zn+2]
InChIKey XKMZOFXGLBYJLS-UHFFFAOYSA-L
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Zinc diacrylate (CAS: 14643-87-9) typically synthesized?

Zinc diacrylate is typically synthesized by the reaction of zinc acetate with acryloyl chloride or a...

Compound Q&A

What industries use Zinc diacrylate (CAS: 14643-87-9)?

Zinc diacrylate (CAS: 14643-87-9) is widely used in the polymer industry, particularly in the prepar...

Compound Q&A

What precautions should be taken when handling Zinc diacrylate (CAS: 14643-87-9)?

When handling Zinc diacrylate (CAS: 14643-87-9), it is important to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...