Compound Q&A

What are the physical and chemical properties of Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 94790-35-9)?

Answer

Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate
Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 94790-35-9) is a crystalline solid with a molecular weight of approximately 356.09 g/mol. It is highly soluble in organic solvents like DMF and DMSO. This compound is known for its reactivity in nucleophilic substitution and alkylation reactions.

About

CAS No 94790-35-9
English Name Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate
Molecular Formula C5H12ClF6N2P
Molecular Weight 280.58 g/mol
SMILES CN(C)C(=[N+](C)C)Cl.F[P-](F)(F)(F)(F)F
InChIKey CUKNPSDEURGZCO-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 94790-35-9) typically synthesized?

Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate is typically synthesized by reac...

Compound Q&A

What industries use Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 94790-35-9)?

Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate finds applications in the pharma...

Compound Q&A

What precautions should be taken when handling Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 94790-35-9)?

When handling Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate, safety goggles, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...