Compound Q&A

What industries use 6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid (CAS: 475-80-9)?

Answer

6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid
6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid finds applications in the pharmaceutical industry for the synthesis of various drugs and intermediates. It is also used in the polymer industry for the development of functional materials and in the semiconductor industry for specific applications requiring precise molecular structures.

About

CAS No 475-80-9
English Name 6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid
Molecular Formula C16H9NO6
Molecular Weight 311.24 g/mol
SMILES C1OC2=C(O1)C3=C(C(=C2)C(=O)O)C(=CC4=CC=CC=C43)[N+](=O)[O-]
InChIKey MEEXETVZNQYRSP-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid (CAS: 475-80-9)?

6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid is a crystalline solid with a molecular weigh...

Compound Q&A

How is 6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid (CAS: 475-80-9) typically synthesized?

6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid can be synthesized via a multi-step procedure...

Compound Q&A

What precautions should be taken when handling 6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid (CAS: 475-80-9)?

When handling 6-Nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...