Compound Q&A

How is 5-(2-Fluoro-3-methoxyphenyl)-1-[2-fluoro-6-(trifluoromethyl)benzyl]-6-methyl-2,4(1H,3H)-pyrimidinedione (CAS: 1150560-59-0) typically synthesized?

Answer

5-(2-Fluoro-3-methoxyphenyl)-1-[2-fluoro-6-(trifluoromethyl)benzyl]-6-methyl-2,4(1H,3H)-pyrimidinedione
This compound can be synthesized through a multi-step process involving Friedel-Crafts alkylation and alkylation reactions, followed by selective amination. The use of trifluoromethylbenzyl halide and appropriate catalysts is crucial for achieving high yield and selectivity. The reaction is typically performed under solvent-free conditions to improve efficiency.

About

English Name 5-(2-Fluoro-3-methoxyphenyl)-1-[2-fluoro-6-(trifluoromethyl)benzyl]-6-methyl-2,4(1H,3H)-pyrimidinedione
Molecular Formula C20H15F5N2O3
Molecular Weight 426.34 g/mol
SMILES COc1cccc(c1F)c1c(=O)[nH]c(=O)n(c1C)Cc1c(F)cccc1C(F)(F)F
InChIKey RKWZHFVZKOVXSK-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(2-Fluoro-3-methoxyphenyl)-1-[2-fluoro-6-(trifluoromethyl)benzyl]-6-methyl-2,4(1H,3H)-pyrimidinedione (CAS: 1150560-59-0)?

The compound has a crystalline form and a molecular weight of approximately 519.26 g/mol. It has low...

Compound Q&A

What industries use 5-(2-Fluoro-3-methoxyphenyl)-1-[2-fluoro-6-(trifluoromethyl)benzyl]-6-methyl-2,4(1H,3H)-pyrimidinedione (CAS: 1150560-59-0)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs. I...

Compound Q&A

What precautions should be taken when handling 5-(2-Fluoro-3-methoxyphenyl)-1-[2-fluoro-6-(trifluoromethyl)benzyl]-6-methyl-2,4(1H,3H)-pyrimidinedione (CAS: 1150560-59-0)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...