Compound Q&A

How is Disodium terephthalate (CAS: 10028-70-3) typically synthesized?

Answer

Disodium terephthalate
Disodium terephthalate is typically synthesized by the esterification of terephthalic acid with sodium hydroxide. The process involves the reaction of terephthalic acid with sodium hydroxide to produce sodium terephthalate, which is then neutralized with sulfuric acid to form the disodium salt. Common catalysts include sulfuric acid and other strong acids, with moderate selectivity and high yield.

About

CAS No 10028-70-3
English Name Disodium terephthalate
Molecular Formula C8H4Na2O4
Molecular Weight 210.09 g/mol
SMILES C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].[Na+].[Na+]
InChIKey VIQSRHWJEKERKR-UHFFFAOYSA-L
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium terephthalate (CAS: 10028-70-3)?

Disodium terephthalate (CAS: 10028-70-3) is a crystalline white powder with a molecular weight of ap...

Compound Q&A

What industries use Disodium terephthalate (CAS: 10028-70-3)?

Disodium terephthalate (CAS: 10028-70-3) is widely used in the polyester industry, particularly in t...

Compound Q&A

What precautions should be taken when handling Disodium terephthalate (CAS: 10028-70-3)?

When handling Disodium terephthalate (CAS: 10028-70-3), proper personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...