Compound Q&A

What precautions should be taken when handling 2-Bromo-N,N-diphenylaniline (CAS: 78600-31-4)?

Answer

2-Bromo-N,N-diphenylaniline
When handling 2-Bromo-N,N-diphenylaniline (CAS: 78600-31-4), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store it in a well-ventilated area and use a fume hood during operations to minimize exposure. In case of a spill, immediately clean up the area with appropriate absorbent materials and consult the Safety Data Sheet (SDS) for further instructions. This compound is toxic and may cause irritation or other health effects if inhaled or ingested.

About

CAS No 78600-31-4
English Name 2-Bromo-N,N-diphenylaniline
Molecular Formula C18H14BrN
Molecular Weight 324.22 g/mol
SMILES C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3Br
InChIKey YPIANBZIVBPMJS-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-N,N-diphenylaniline (CAS: 78600-31-4)?

2-Bromo-N,N-diphenylaniline (CAS: 78600-31-4) is a solid with a crystalline form. It has a molecular...

Compound Q&A

How is 2-Bromo-N,N-diphenylaniline (CAS: 78600-31-4) typically synthesized?

2-Bromo-N,N-diphenylaniline is typically synthesized through the bromination of N,N-diphenylaniline ...

Compound Q&A

What industries use 2-Bromo-N,N-diphenylaniline (CAS: 78600-31-4)?

2-Bromo-N,N-diphenylaniline (CAS: 78600-31-4) is used in various industries, primarily in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...