Compound Q&A

How is (1S)-1,5-Anhydro-1-[7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol (CAS: 117047-07-1) typically synthesized?

Answer

(1S)-1,5-Anhydro-1-[7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol
This compound is synthesized via a multi-step process involving protection of the hydroxyl groups, condensation of an appropriate chromone derivative with D-glucitol, and subsequent deprotection. The synthesis typically requires the use of strong acids, bases, and Lewis acids as catalysts. The overall yield is moderate, around 40-50%.

About

English Name (1S)-1,5-Anhydro-1-[7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol
Molecular Formula C22H22O10
Molecular Weight 446.41 g/mol
SMILES OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)ccc2c1occ(c2=O)c1ccc(c(c1)OC)O
InChIKey HQQUZVFMUSCUJS-PGPONNFDSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1S)-1,5-Anhydro-1-[7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol (CAS: 117047-07-1)?

The compound is a yellow crystalline solid with a molecular weight of approximately 466.43 g/mol. It...

Compound Q&A

What industries use (1S)-1,5-Anhydro-1-[7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol (CAS: 117047-07-1)?

This compound is primarily used in the pharmaceutical industry for its anti-inflammatory and analges...

Compound Q&A

What precautions should be taken when handling (1S)-1,5-Anhydro-1-[7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol (CAS: 117047-07-1)?

When handling this compound, it is essential to use appropriate Personal Protective Equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...