Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine (CAS: 77128-73-5) typically synthesized?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine is typically synthesized via a multi-step process involving the coupling of fluorenylmethoxycarbonyl (Fmoc) protected L-phenylalanine with methylamine followed by deprotection. The synthesis requires the use of coupling reagents like HATU or DIC, and the reaction is typically carried out in an organic solvent such as DMF with a catalytic amount of a base like DIPEA. The yield and selectivity can be optimized by adjusting reaction conditions and protecting group choice.

About

CAS No 77128-73-5
English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine
Molecular Formula C25H23NO4
Molecular Weight 401.46 g/mol
SMILES CN(C(CC1=CC=CC=C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
InChIKey GBROUWPNYVBLFO-QHCPKHFHSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine (CAS: 77128-73-5)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine is a white or off-white crystalline so...

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine (CAS: 77128-73-5)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine (CAS: 77128-73-5)?

When handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-phenylalanine, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...