Compound Q&A

What are the physical and chemical properties of 4-tert-Butoxystyrene (CAS: 95418-58-9)?

Answer

4-tert-Butoxystyrene
4-tert-Butoxystyrene (CAS: 95418-58-9) is a colorless to light yellow liquid with a pungent odor. Its molecular weight is approximately 180.25 g/mol. This compound has a high solubility in organic solvents such as toluene and dichloromethane. It is generally stable but can undergo polymerization if exposed to heat or strong acids. It reacts with nucleophiles to form substituted products.

About

CAS No 95418-58-9
English Name 4-tert-Butoxystyrene
Molecular Formula C12H16O
Molecular Weight 176.26 g/mol
SMILES CC(C)(C)OC1=CC=C(C=C1)C=C
InChIKey GRFNSWBVXHLTCI-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 4-tert-Butoxystyrene (CAS: 95418-58-9) typically synthesized?

4-tert-Butoxystyrene (CAS: 95418-58-9) is typically synthesized via Wittig reaction using tert-butyl...

Compound Q&A

What industries use 4-tert-Butoxystyrene (CAS: 95418-58-9)?

4-tert-Butoxystyrene (CAS: 95418-58-9) is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 4-tert-Butoxystyrene (CAS: 95418-58-9)?

When handling 4-tert-Butoxystyrene (CAS: 95418-58-9), it is important to use appropriate Personal Pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...