Compound Q&A

What are the physical and chemical properties of Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)- (CAS: 136790-76-6)?

Answer

Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)-
Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)- is a solid with a crystalline form. Its molecular weight is approximately 422.11 g/mol. This compound has limited water solubility and is soluble in organic solvents like ethanol and chloroform. It exhibits moderate reactivity towards nucleophiles and is somewhat stable under neutral conditions. The compound is typically used for research purposes and has limited industrial applications.

About

English Name Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)-
Molecular Formula C20H32F2O5
Molecular Weight 390.46 g/mol
EINECS 634-172-9
SMILES CCCCC(C(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O)(F)F
InChIKey DBVFKLAGQHYVGQ-BFYDXBDKSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)- (CAS: 136790-76-6) typically synthesized?

Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)- is often synthesized through a mul...

Compound Q&A

What industries use Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)- (CAS: 136790-76-6)?

Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)- is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)- (CAS: 136790-76-6)?

When handling Prostan-1-oic acid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)-, it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...