Compound Q&A

What are the main uses of [(hydrazinecarbonyl)methyl]trimethylazanium chloride (CAS: 123-46-6)?

Answer

[(hydrazinecarbonyl)methyl]trimethylazanium chloride
The main uses of [(hydrazinecarbonyl)methyl]trimethylazanium chloride (CAS: 123-46-6) include its application in organic synthesis as a reagent, catalyst, and ligand. It is also used in the preparation of various pharmaceuticals and in the research of new materials. Additionally, it plays a role in the development of advanced polymer materials and as an intermediate in the synthesis of other azo dyes.

About

CAS No 123-46-6
English Name [(hydrazinecarbonyl)methyl]trimethylazanium chloride
Molecular Formula C5H14ClN3O
Molecular Weight 167.64 g/mol
SMILES C[N+](C)(C)CC(=O)NN.[Cl-]
InChIKey YSULOORXQBDPCU-UHFFFAOYSA-N
Last Updated: 2025-09-25 07:24

Related Q&A

Compound Q&A

What is [(hydrazinecarbonyl)methyl]trimethylazanium chloride (CAS: 123-46-6)?

[(hydrazinecarbonyl)methyl]trimethylazanium chloride is a chemical compound with the CAS number 123-...

Compound Q&A

Is [(hydrazinecarbonyl)methyl]trimethylazanium chloride (CAS: 123-46-6) safe?

[(hydrazinecarbonyl)methyl]trimethylazanium chloride (CAS: 123-46-6) is generally considered safe wh...

Compound Q&A

How should [(hydrazinecarbonyl)methyl]trimethylazanium chloride (CAS: 123-46-6) be stored?

[(hydrazinecarbonyl)methyl]trimethylazanium chloride (CAS: 123-46-6) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...